C17H19NOS — CID 106953930
4-(3,4-dihydro-1H-isothiochromen-4-ylamino)-2,5-dimethylphenol (PubChem CID 106953930) has the molecular formula C17H19NOS and a molecular weight of 285.41 g/mol. Its IUPAC name is 4-(3,4-dihydro-1H-isothiochromen-4-ylamino)-2,5-dimethylphenol.
| Compound Name | 4-(3,4-dihydro-1H-isothiochromen-4-ylamino)-2,5-dimethylphenol |
|---|---|
| PubChem CID | 106953930 |
| Molecular Formula | C17H19NOS |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 4-(3,4-dihydro-1H-isothiochromen-4-ylamino)-2,5-dimethylphenol |
| SMILES | Cc1cc(NC2CSCc3ccccc32)c(C)cc1O |
| InChI | InChI=1S/C17H19NOS/c1-11-8-17(19)12(2)7-15(11)18-16-10-20-9-13-5-3-4-6-14(13)16/h3-8,16,18-19H,9-10H2,1-2H3 |
| InChIKey | YREJCXXAPDWTGY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|