C22H27BrN4O4 — CID 10696433
3-(4-bromophenyl)-5-[2-[5-[(4-methyl-2-pyridinyl)amino]pentanoyl]hydrazinyl]-5-oxopentanoic acid (PubChem CID 10696433) has the molecular formula C22H27BrN4O4 and a molecular weight of 491.39 g/mol. Its IUPAC name is 3-(4-bromophenyl)-5-[2-[5-[(4-methyl-2-pyridinyl)amino]pentanoyl]hydrazinyl]-5-oxopentanoic acid.
| Compound Name | 3-(4-bromophenyl)-5-[2-[5-[(4-methyl-2-pyridinyl)amino]pentanoyl]hydrazinyl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 10696433 |
| Molecular Formula | C22H27BrN4O4 |
| Molecular Weight | 491.39 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 3-(4-bromophenyl)-5-[2-[5-[(4-methyl-2-pyridinyl)amino]pentanoyl]hydrazinyl]-5-oxopentanoic acid |
| SMILES | Cc1ccnc(NCCCCC(=O)NNC(=O)CC(CC(=O)O)c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C22H27BrN4O4/c1-15-9-11-25-19(12-15)24-10-3-2-4-20(28)26-27-21(29)13-17(14-22(30)31)16-5-7-18(23)8-6-16/h5-9,11-12,17H,2-4,10,13-14H2,1H3,(H,24,25)(H,26,28)(H,27,29)(H,30,31) |
| InChIKey | XCAFGCVKKHXFCE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|