About CID 10696444
CID 10696444 (PubChem CID 10696444) has the molecular formula C21H28NOSSi
and a molecular weight of 370.61 g/mol.
Molecular Properties
| Compound Name | CID 10696444 |
| PubChem CID | 10696444 |
| Molecular Formula | C21H28NOSSi |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[C@H]1COC([C]2[C](Sc3ccccc3)[CH][CH][C]2[Si](C)(C)C)=N1 |
| InChI | InChI=1S/C21H28NOSSi/c1-21(2,3)18-14-23-20(22-18)19-16(12-13-17(19)25(4,5)6)24-15-10-8-7-9-11-15/h7-13,18H,14H2,1-6H3/t18-/m1/s1 |
| InChIKey | NEBNTFLEIVJIQF-GOSISDBHSA-N |
| XLogP | 5.60 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 10696444 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10696444?
The IUPAC name of CID 10696444 (CID 10696444) is not available.
What is the SMILES notation for CID 10696444?
The canonical SMILES for CID 10696444 is CC(C)(C)[C@H]1COC([C]2[C](Sc3ccccc3)[CH][CH][C]2[Si](C)(C)C)=N1.
What is the InChIKey of CID 10696444?
The InChIKey is NEBNTFLEIVJIQF-GOSISDBHSA-N. The full InChI is InChI=1S/C21H28NOSSi/c1-21(2,3)18-14-23-20(22-18)19-16(12-13-17(19)25(4,5)6)24-15-10-8-7-9-11-15/h7-13,18H,14H2,1-6H3/t18-/m1/s1.
What are the key properties of CID 10696444?
CID 10696444 has a molecular weight of 370.61 g/mol, XLogP of 5.60, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10696444 is sourced from PubChem (CID 10696444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).