C17H26N2 — CID 106976204
1-[(2-propylpyrrolidin-2-yl)methyl]-3,4-dihydro-2H-quinoline (PubChem CID 106976204) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 1-[(2-propylpyrrolidin-2-yl)methyl]-3,4-dihydro-2H-quinoline.
| Compound Name | 1-[(2-propylpyrrolidin-2-yl)methyl]-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 106976204 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 1-[(2-propylpyrrolidin-2-yl)methyl]-3,4-dihydro-2H-quinoline |
| SMILES | CCCC1(CN2CCCc3ccccc32)CCCN1 |
| InChI | InChI=1S/C17H26N2/c1-2-10-17(11-6-12-18-17)14-19-13-5-8-15-7-3-4-9-16(15)19/h3-4,7,9,18H,2,5-6,8,10-14H2,1H3 |
| InChIKey | WIEJFJAXBFVHLM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |