About 3-methyl-1-[(2-propylpyrrolidin-2-yl)methyl]-3,4-dihydro-2H-quinoline
3-methyl-1-[(2-propylpyrrolidin-2-yl)methyl]-3,4-dihydro-2H-quinoline (PubChem CID 106976426) has the molecular formula C18H28N2
and a molecular weight of 272.44 g/mol. Its IUPAC name is 3-methyl-1-[(2-propylpyrrolidin-2-yl)methyl]-3,4-dihydro-2H-quinoline.
Molecular Properties
| Compound Name | 3-methyl-1-[(2-propylpyrrolidin-2-yl)methyl]-3,4-dihydro-2H-quinoline |
| PubChem CID | 106976426 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 3-methyl-1-[(2-propylpyrrolidin-2-yl)methyl]-3,4-dihydro-2H-quinoline |
| SMILES | CCCC1(CN2CC(C)Cc3ccccc32)CCCN1 |
| InChI | InChI=1S/C18H28N2/c1-3-9-18(10-6-11-19-18)14-20-13-15(2)12-16-7-4-5-8-17(16)20/h4-5,7-8,15,19H,3,6,9-14H2,1-2H3 |
| InChIKey | LMRYTYPQJKZBFJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-1-[(2-propylpyrrolidin-2-yl)methyl]-3,4-dihydro-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-[(2-propylpyrrolidin-2-yl)methyl]-3,4-dihydro-2H-quinoline?
The IUPAC name of 3-methyl-1-[(2-propylpyrrolidin-2-yl)methyl]-3,4-dihydro-2H-quinoline (CID 106976426) is 3-methyl-1-[(2-propylpyrrolidin-2-yl)methyl]-3,4-dihydro-2H-quinoline.
What is the SMILES notation for 3-methyl-1-[(2-propylpyrrolidin-2-yl)methyl]-3,4-dihydro-2H-quinoline?
The canonical SMILES for 3-methyl-1-[(2-propylpyrrolidin-2-yl)methyl]-3,4-dihydro-2H-quinoline is CCCC1(CN2CC(C)Cc3ccccc32)CCCN1.
What is the InChIKey of 3-methyl-1-[(2-propylpyrrolidin-2-yl)methyl]-3,4-dihydro-2H-quinoline?
The InChIKey is LMRYTYPQJKZBFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2/c1-3-9-18(10-6-11-19-18)14-20-13-15(2)12-16-7-4-5-8-17(16)20/h4-5,7-8,15,19H,3,6,9-14H2,1-2H3.
What are the key properties of 3-methyl-1-[(2-propylpyrrolidin-2-yl)methyl]-3,4-dihydro-2H-quinoline?
3-methyl-1-[(2-propylpyrrolidin-2-yl)methyl]-3,4-dihydro-2H-quinoline has a molecular weight of 272.44 g/mol, XLogP of 3.61, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-[(2-propylpyrrolidin-2-yl)methyl]-3,4-dihydro-2H-quinoline is sourced from PubChem (CID 106976426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).