C32H53NO5Si — CID 10698098
[(2R,3E,3aS,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-3-[5-(methoxymethoxy)-5-methylhexylidene]-3a-methyl-2,4,5,6,7,7a-hexahydro-1H-inden-2-yl] N-phenylcarbamate (PubChem CID 10698098) has the molecular formula C32H53NO5Si and a molecular weight of 559.86 g/mol. Its IUPAC name is [(2R,3E,3aS,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-3-[5-(methoxymethoxy)-5-methylhexylidene]-3a-methyl-2,4,5,6,7,7a-hexahydro-1H-inden-2-yl] N-phenylcarbamate.
| Compound Name | [(2R,3E,3aS,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-3-[5-(methoxymethoxy)-5-methylhexylidene]-3a-methyl-2,4,5,6,7,7a-hexahydro-1H-inden-2-yl] N-phenylcarbamate |
|---|---|
| PubChem CID | 10698098 |
| Molecular Formula | C32H53NO5Si |
| Molecular Weight | 559.86 g/mol |
| Exact Mass | 559.37 |
| IUPAC Name | [(2R,3E,3aS,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-3-[5-(methoxymethoxy)-5-methylhexylidene]-3a-methyl-2,4,5,6,7,7a-hexahydro-1H-inden-2-yl] N-phenylcarbamate |
| SMILES | COCOC(C)(C)CCC/C=C1/[C@H](OC(=O)Nc2ccccc2)C[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C32H53NO5Si/c1-30(2,3)39(8,9)38-27-19-15-21-32(6)25(18-13-14-20-31(4,5)36-23-35-7)28(22-26(27)32)37-29(34)33-24-16-11-10-12-17-24/h10-12,16-18,26-28H,13-15,19-23H2,1-9H3,(H,33,34)/b25-18-/t26-,27-,28+,32+/m0/s1 |
| InChIKey | VTKUXNFHJHQFAH-BVPGJEIISA-N |
| XLogP | 8.70 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.86 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|