C22H38O4Si — CID 101187555
[(2R,3Z,3aS,7S,7aR)-3-ethylidene-3a-methyl-7-triethylsilyloxy-2,4,5,6,7,7a-hexahydro-1H-inden-2-yl] 3-oxobutanoate (PubChem CID 101187555) has the molecular formula C22H38O4Si and a molecular weight of 394.63 g/mol. Its IUPAC name is [(2R,3Z,3aS,7S,7aR)-3-ethylidene-3a-methyl-7-triethylsilyloxy-2,4,5,6,7,7a-hexahydro-1H-inden-2-yl] 3-oxobutanoate.
| Compound Name | [(2R,3Z,3aS,7S,7aR)-3-ethylidene-3a-methyl-7-triethylsilyloxy-2,4,5,6,7,7a-hexahydro-1H-inden-2-yl] 3-oxobutanoate |
|---|---|
| PubChem CID | 101187555 |
| Molecular Formula | C22H38O4Si |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | [(2R,3Z,3aS,7S,7aR)-3-ethylidene-3a-methyl-7-triethylsilyloxy-2,4,5,6,7,7a-hexahydro-1H-inden-2-yl] 3-oxobutanoate |
| SMILES | C/C=C1\[C@H](OC(=O)CC(C)=O)C[C@H]2[C@@H](O[Si](CC)(CC)CC)CCC[C@]12C |
| InChI | InChI=1S/C22H38O4Si/c1-7-17-20(25-21(24)14-16(5)23)15-18-19(12-11-13-22(17,18)6)26-27(8-2,9-3)10-4/h7,18-20H,8-15H2,1-6H3/b17-7+/t18-,19-,20+,22+/m0/s1 |
| InChIKey | ZYBBIEQNPDJEHR-LCDWCQHUSA-N |
| XLogP | 5.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|