C14H17Cl2NO — CID 106986700
5,7-dichloro-3-(3,3-dimethylbutyl)-1,3-dihydroindol-2-one (PubChem CID 106986700) has the molecular formula C14H17Cl2NO and a molecular weight of 286.20 g/mol. Its IUPAC name is 5,7-dichloro-3-(3,3-dimethylbutyl)-1,3-dihydroindol-2-one.
| Compound Name | 5,7-dichloro-3-(3,3-dimethylbutyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 106986700 |
| Molecular Formula | C14H17Cl2NO |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 5,7-dichloro-3-(3,3-dimethylbutyl)-1,3-dihydroindol-2-one |
| SMILES | CC(C)(C)CCC1C(=O)Nc2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C14H17Cl2NO/c1-14(2,3)5-4-9-10-6-8(15)7-11(16)12(10)17-13(9)18/h6-7,9H,4-5H2,1-3H3,(H,17,18) |
| InChIKey | WECXZUBJODGAAK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |