C8H17NO — CID 107004727
1-(2,2-dimethylcyclopropyl)-2-methoxyethanamine (PubChem CID 107004727) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is 1-(2,2-dimethylcyclopropyl)-2-methoxyethanamine.
| Compound Name | 1-(2,2-dimethylcyclopropyl)-2-methoxyethanamine |
|---|---|
| PubChem CID | 107004727 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 1-(2,2-dimethylcyclopropyl)-2-methoxyethanamine |
| SMILES | COCC(N)C1CC1(C)C |
| InChI | InChI=1S/C8H17NO/c1-8(2)4-6(8)7(9)5-10-3/h6-7H,4-5,9H2,1-3H3 |
| InChIKey | CGQFIBAVMKGGQB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |