C11H23NO2S — CID 107032948
N,3-dimethyl-N-(2-propan-2-yloxyethyl)-2-sulfanylbutanamide (PubChem CID 107032948) has the molecular formula C11H23NO2S and a molecular weight of 233.38 g/mol. Its IUPAC name is N,3-dimethyl-N-(2-propan-2-yloxyethyl)-2-sulfanylbutanamide.
| Compound Name | N,3-dimethyl-N-(2-propan-2-yloxyethyl)-2-sulfanylbutanamide |
|---|---|
| PubChem CID | 107032948 |
| Molecular Formula | C11H23NO2S |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | N,3-dimethyl-N-(2-propan-2-yloxyethyl)-2-sulfanylbutanamide |
| SMILES | CC(C)OCCN(C)C(=O)C(S)C(C)C |
| InChI | InChI=1S/C11H23NO2S/c1-8(2)10(15)11(13)12(5)6-7-14-9(3)4/h8-10,15H,6-7H2,1-5H3 |
| InChIKey | UQYRSGLEIABDDL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|