C10H10N6O3S — CID 107052239
2-[(2-methyltetrazol-5-yl)methylsulfonyl]-1,3-benzoxazol-5-amine (PubChem CID 107052239) has the molecular formula C10H10N6O3S and a molecular weight of 294.30 g/mol. Its IUPAC name is 2-[(2-methyltetrazol-5-yl)methylsulfonyl]-1,3-benzoxazol-5-amine.
| Compound Name | 2-[(2-methyltetrazol-5-yl)methylsulfonyl]-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 107052239 |
| Molecular Formula | C10H10N6O3S |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 2-[(2-methyltetrazol-5-yl)methylsulfonyl]-1,3-benzoxazol-5-amine |
| SMILES | Cn1nnc(CS(=O)(=O)c2nc3cc(N)ccc3o2)n1 |
| InChI | InChI=1S/C10H10N6O3S/c1-16-14-9(13-15-16)5-20(17,18)10-12-7-4-6(11)2-3-8(7)19-10/h2-4H,5,11H2,1H3 |
| InChIKey | KUMFEJRZVHZSDL-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 129.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|