C13H16O5 — CID 10705946
(Z)-2-(4-methoxycarbonyl-2-prop-1-en-2-yl-2,3-dihydrofuran-5-yl)but-2-enoic acid (PubChem CID 10705946) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is (Z)-2-(4-methoxycarbonyl-2-prop-1-en-2-yl-2,3-dihydrofuran-5-yl)but-2-enoic acid.
| Compound Name | (Z)-2-(4-methoxycarbonyl-2-prop-1-en-2-yl-2,3-dihydrofuran-5-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 10705946 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | (Z)-2-(4-methoxycarbonyl-2-prop-1-en-2-yl-2,3-dihydrofuran-5-yl)but-2-enoic acid |
| SMILES | C=C(C)C1CC(C(=O)OC)=C(/C(=C/C)C(=O)O)O1 |
| InChI | InChI=1S/C13H16O5/c1-5-8(12(14)15)11-9(13(16)17-4)6-10(18-11)7(2)3/h5,10H,2,6H2,1,3-4H3,(H,14,15)/b8-5- |
| InChIKey | OMVXUILERROLCQ-YVMONPNESA-N |
| XLogP | 1.81 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|