C12H22N4O — CID 107063225
4,6,6-trimethyl-1-(2-methyltetrazol-5-yl)heptan-2-one (PubChem CID 107063225) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is 4,6,6-trimethyl-1-(2-methyltetrazol-5-yl)heptan-2-one.
| Compound Name | 4,6,6-trimethyl-1-(2-methyltetrazol-5-yl)heptan-2-one |
|---|---|
| PubChem CID | 107063225 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 4,6,6-trimethyl-1-(2-methyltetrazol-5-yl)heptan-2-one |
| SMILES | CC(CC(=O)Cc1nnn(C)n1)CC(C)(C)C |
| InChI | InChI=1S/C12H22N4O/c1-9(8-12(2,3)4)6-10(17)7-11-13-15-16(5)14-11/h9H,6-8H2,1-5H3 |
| InChIKey | JYGKEURGVZVTBE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |