C14H21BrF2N2 — CID 107085530
2-N-[4-(bromomethyl)-2,6-difluorophenyl]-2-N-ethyl-1-N,1-N-dimethylpropane-1,2-diamine (PubChem CID 107085530) has the molecular formula C14H21BrF2N2 and a molecular weight of 335.24 g/mol. Its IUPAC name is 2-N-[4-(bromomethyl)-2,6-difluorophenyl]-2-N-ethyl-1-N,1-N-dimethylpropane-1,2-diamine.
| Compound Name | 2-N-[4-(bromomethyl)-2,6-difluorophenyl]-2-N-ethyl-1-N,1-N-dimethylpropane-1,2-diamine |
|---|---|
| PubChem CID | 107085530 |
| Molecular Formula | C14H21BrF2N2 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 2-N-[4-(bromomethyl)-2,6-difluorophenyl]-2-N-ethyl-1-N,1-N-dimethylpropane-1,2-diamine |
| SMILES | CCN(c1c(F)cc(CBr)cc1F)C(C)CN(C)C |
| InChI | InChI=1S/C14H21BrF2N2/c1-5-19(10(2)9-18(3)4)14-12(16)6-11(8-15)7-13(14)17/h6-7,10H,5,8-9H2,1-4H3 |
| InChIKey | JIIQSNJVUHUOAM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|