C16H16BrF2N — CID 107082552
4-(bromomethyl)-N-ethyl-2,6-difluoro-N-(4-methylphenyl)aniline (PubChem CID 107082552) has the molecular formula C16H16BrF2N and a molecular weight of 340.21 g/mol. Its IUPAC name is 4-(bromomethyl)-N-ethyl-2,6-difluoro-N-(4-methylphenyl)aniline.
| Compound Name | 4-(bromomethyl)-N-ethyl-2,6-difluoro-N-(4-methylphenyl)aniline |
|---|---|
| PubChem CID | 107082552 |
| Molecular Formula | C16H16BrF2N |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 4-(bromomethyl)-N-ethyl-2,6-difluoro-N-(4-methylphenyl)aniline |
| SMILES | CCN(c1ccc(C)cc1)c1c(F)cc(CBr)cc1F |
| InChI | InChI=1S/C16H16BrF2N/c1-3-20(13-6-4-11(2)5-7-13)16-14(18)8-12(10-17)9-15(16)19/h4-9H,3,10H2,1-2H3 |
| InChIKey | NDVFXXJODREYME-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|