C12H14N4O4S — CID 10710078
(3Z)-N-(diaminomethylidene)-3-methoxyimino-5-methyl-1,1-dioxo-1-benzothiophene-6-carboxamide (PubChem CID 10710078) has the molecular formula C12H14N4O4S and a molecular weight of 310.34 g/mol. Its IUPAC name is (3Z)-N-(diaminomethylidene)-3-methoxyimino-5-methyl-1,1-dioxo-1-benzothiophene-6-carboxamide.
| Compound Name | (3Z)-N-(diaminomethylidene)-3-methoxyimino-5-methyl-1,1-dioxo-1-benzothiophene-6-carboxamide |
|---|---|
| PubChem CID | 10710078 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | (3Z)-N-(diaminomethylidene)-3-methoxyimino-5-methyl-1,1-dioxo-1-benzothiophene-6-carboxamide |
| SMILES | CO/N=C1\CS(=O)(=O)c2cc(C(=O)N=C(N)N)c(C)cc21 |
| InChI | InChI=1S/C12H14N4O4S/c1-6-3-8-9(16-20-2)5-21(18,19)10(8)4-7(6)11(17)15-12(13)14/h3-4H,5H2,1-2H3,(H4,13,14,15,17)/b16-9+ |
| InChIKey | GULFTNWMBQBESD-CXUHLZMHSA-N |
| XLogP | -0.45 |
| TPSA | 137.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|