C13H15N3O3S — CID 19354848
N-(diaminomethylidene)-2,6-dimethyl-1,1-dioxo-4H-thiochromene-7-carboxamide (PubChem CID 19354848) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is N-(diaminomethylidene)-2,6-dimethyl-1,1-dioxo-4H-thiochromene-7-carboxamide.
| Compound Name | N-(diaminomethylidene)-2,6-dimethyl-1,1-dioxo-4H-thiochromene-7-carboxamide |
|---|---|
| PubChem CID | 19354848 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | N-(diaminomethylidene)-2,6-dimethyl-1,1-dioxo-4H-thiochromene-7-carboxamide |
| SMILES | CC1=CCc2cc(C)c(C(=O)N=C(N)N)cc2S1(=O)=O |
| InChI | InChI=1S/C13H15N3O3S/c1-7-5-9-4-3-8(2)20(18,19)11(9)6-10(7)12(17)16-13(14)15/h3,5-6H,4H2,1-2H3,(H4,14,15,16,17) |
| InChIKey | VRXVDTNTHHVCHS-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|