C14H17N3O2 — CID 146032606
N-(diaminomethylidene)-2,2,7-trimethylchromene-6-carboxamide (PubChem CID 146032606) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is N-(diaminomethylidene)-2,2,7-trimethylchromene-6-carboxamide.
| Compound Name | N-(diaminomethylidene)-2,2,7-trimethylchromene-6-carboxamide |
|---|---|
| PubChem CID | 146032606 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | N-(diaminomethylidene)-2,2,7-trimethylchromene-6-carboxamide |
| SMILES | Cc1cc2c(cc1C(=O)N=C(N)N)C=CC(C)(C)O2 |
| InChI | InChI=1S/C14H17N3O2/c1-8-6-11-9(4-5-14(2,3)19-11)7-10(8)12(18)17-13(15)16/h4-7H,1-3H3,(H4,15,16,17,18) |
| InChIKey | QWHWAQUCUIGBAE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|