C11H10BrF2NO — CID 107102342
N-[(4-bromo-6,7-difluoro-1-benzofuran-2-yl)methyl]ethanamine (PubChem CID 107102342) has the molecular formula C11H10BrF2NO and a molecular weight of 290.11 g/mol. Its IUPAC name is N-[(4-bromo-6,7-difluoro-1-benzofuran-2-yl)methyl]ethanamine.
| Compound Name | N-[(4-bromo-6,7-difluoro-1-benzofuran-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 107102342 |
| Molecular Formula | C11H10BrF2NO |
| Molecular Weight | 290.11 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | N-[(4-bromo-6,7-difluoro-1-benzofuran-2-yl)methyl]ethanamine |
| SMILES | CCNCc1cc2c(Br)cc(F)c(F)c2o1 |
| InChI | InChI=1S/C11H10BrF2NO/c1-2-15-5-6-3-7-8(12)4-9(13)10(14)11(7)16-6/h3-4,15H,2,5H2,1H3 |
| InChIKey | QUTHSAPIGSBRIM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.11 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|