C7H3BrClF2NO4S — CID 107103008
(5-bromo-2,3-difluorophenyl) N-chlorosulfonylcarbamate (PubChem CID 107103008) has the molecular formula C7H3BrClF2NO4S and a molecular weight of 350.52 g/mol. Its IUPAC name is (5-bromo-2,3-difluorophenyl) N-chlorosulfonylcarbamate.
| Compound Name | (5-bromo-2,3-difluorophenyl) N-chlorosulfonylcarbamate |
|---|---|
| PubChem CID | 107103008 |
| Molecular Formula | C7H3BrClF2NO4S |
| Molecular Weight | 350.52 g/mol |
| Exact Mass | 348.86 |
| IUPAC Name | (5-bromo-2,3-difluorophenyl) N-chlorosulfonylcarbamate |
| SMILES | O=C(NS(=O)(=O)Cl)Oc1cc(Br)cc(F)c1F |
| InChI | InChI=1S/C7H3BrClF2NO4S/c8-3-1-4(10)6(11)5(2-3)16-7(13)12-17(9,14)15/h1-2H,(H,12,13) |
| InChIKey | ZETADXABLFGQEL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.52 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|