C15H28NO5P — CID 10711692
(4R,5S)-4-[[[di(propan-2-yl)amino]-prop-2-enoxyphosphanyl]oxymethyl]-5-(hydroxymethyl)oxolan-2-one (PubChem CID 10711692) has the molecular formula C15H28NO5P and a molecular weight of 333.37 g/mol. Its IUPAC name is (4R,5S)-4-[[[di(propan-2-yl)amino]-prop-2-enoxyphosphanyl]oxymethyl]-5-(hydroxymethyl)oxolan-2-one.
| Compound Name | (4R,5S)-4-[[[di(propan-2-yl)amino]-prop-2-enoxyphosphanyl]oxymethyl]-5-(hydroxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 10711692 |
| Molecular Formula | C15H28NO5P |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | (4R,5S)-4-[[[di(propan-2-yl)amino]-prop-2-enoxyphosphanyl]oxymethyl]-5-(hydroxymethyl)oxolan-2-one |
| SMILES | C=CCOP(OC[C@H]1CC(=O)O[C@@H]1CO)N(C(C)C)C(C)C |
| InChI | InChI=1S/C15H28NO5P/c1-6-7-19-22(16(11(2)3)12(4)5)20-10-13-8-15(18)21-14(13)9-17/h6,11-14,17H,1,7-10H2,2-5H3/t13-,14-,22?/m1/s1 |
| InChIKey | NVBRPZIZTHGCGH-PMBFKINQSA-N |
| XLogP | 2.48 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|