C11H17NO5 — CID 59947449
prop-2-enyl N-[(3S)-5-oxo-2-propan-2-yloxyoxolan-3-yl]carbamate (PubChem CID 59947449) has the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. Its IUPAC name is prop-2-enyl N-[(3S)-5-oxo-2-propan-2-yloxyoxolan-3-yl]carbamate.
| Compound Name | prop-2-enyl N-[(3S)-5-oxo-2-propan-2-yloxyoxolan-3-yl]carbamate |
|---|---|
| PubChem CID | 59947449 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | prop-2-enyl N-[(3S)-5-oxo-2-propan-2-yloxyoxolan-3-yl]carbamate |
| SMILES | C=CCOC(=O)N[C@H]1CC(=O)OC1OC(C)C |
| InChI | InChI=1S/C11H17NO5/c1-4-5-15-11(14)12-8-6-9(13)17-10(8)16-7(2)3/h4,7-8,10H,1,5-6H2,2-3H3,(H,12,14)/t8-,10?/m0/s1 |
| InChIKey | SAEQCWBCVOPWHL-PEHGTWAWSA-N |
| XLogP | 0.97 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|