C40H50N3O8P — CID 11320132
1-[(2R,4S,5R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-5-[[[di(propan-2-yl)amino]-prop-2-enoxyphosphanyl]oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 11320132) has the molecular formula C40H50N3O8P and a molecular weight of 731.83 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-5-[[[di(propan-2-yl)amino]-prop-2-enoxyphosphanyl]oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-5-[[[di(propan-2-yl)amino]-prop-2-enoxyphosphanyl]oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11320132 |
| Molecular Formula | C40H50N3O8P |
| Molecular Weight | 731.83 g/mol |
| Exact Mass | 731.33 |
| IUPAC Name | 1-[(2R,4S,5R)-4-[bis(4-methoxyphenyl)-phenylmethoxy]-5-[[[di(propan-2-yl)amino]-prop-2-enoxyphosphanyl]oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | C=CCOP(OC[C@H]1O[C@@H](n2cc(C)c(=O)[nH]c2=O)C[C@@H]1OC(c1ccccc1)(c1ccc(OC)cc1)c1ccc(OC)cc1)N(C(C)C)C(C)C |
| InChI | InChI=1S/C40H50N3O8P/c1-9-23-48-52(43(27(2)3)28(4)5)49-26-36-35(24-37(50-36)42-25-29(6)38(44)41-39(42)45)51-40(30-13-11-10-12-14-30,31-15-19-33(46-7)20-16-31)32-17-21-34(47-8)22-18-32/h9-22,25,27-28,35-37H,1,23-24,26H2,2-8H3,(H,41,44,45)/t35-,36+,37+,52?/m0/s1 |
| InChIKey | PIXLOLLZIAXAON-SIHXTDFISA-N |
| XLogP | 7.09 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.83 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|