About methyl 2-(thiolan-3-yl)-2-(2,2,2-trifluoroethylamino)acetate
methyl 2-(thiolan-3-yl)-2-(2,2,2-trifluoroethylamino)acetate (PubChem CID 107133066) has the molecular formula C9H14F3NO2S
and a molecular weight of 257.28 g/mol. Its IUPAC name is methyl 2-(thiolan-3-yl)-2-(2,2,2-trifluoroethylamino)acetate.
Analyze methyl 2-(thiolan-3-yl)-2-(2,2,2-trifluoroethylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(thiolan-3-yl)-2-(2,2,2-trifluoroethylamino)acetate?
The IUPAC name of methyl 2-(thiolan-3-yl)-2-(2,2,2-trifluoroethylamino)acetate (CID 107133066) is methyl 2-(thiolan-3-yl)-2-(2,2,2-trifluoroethylamino)acetate.
What is the SMILES notation for methyl 2-(thiolan-3-yl)-2-(2,2,2-trifluoroethylamino)acetate?
The canonical SMILES for methyl 2-(thiolan-3-yl)-2-(2,2,2-trifluoroethylamino)acetate is COC(=O)C(NCC(F)(F)F)C1CCSC1.
What is the InChIKey of methyl 2-(thiolan-3-yl)-2-(2,2,2-trifluoroethylamino)acetate?
The InChIKey is DFZHRBDQBLMXGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F3NO2S/c1-15-8(14)7(6-2-3-16-4-6)13-5-9(10,11)12/h6-7,13H,2-5H2,1H3.
What are the key properties of methyl 2-(thiolan-3-yl)-2-(2,2,2-trifluoroethylamino)acetate?
methyl 2-(thiolan-3-yl)-2-(2,2,2-trifluoroethylamino)acetate has a molecular weight of 257.28 g/mol, XLogP of 1.43, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(thiolan-3-yl)-2-(2,2,2-trifluoroethylamino)acetate is sourced from PubChem (CID 107133066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).