C10H16F3NO2S — CID 107133067
ethyl 2-(thiolan-3-yl)-2-(2,2,2-trifluoroethylamino)acetate (PubChem CID 107133067) has the molecular formula C10H16F3NO2S and a molecular weight of 271.30 g/mol. Its IUPAC name is ethyl 2-(thiolan-3-yl)-2-(2,2,2-trifluoroethylamino)acetate.
| Compound Name | ethyl 2-(thiolan-3-yl)-2-(2,2,2-trifluoroethylamino)acetate |
|---|---|
| PubChem CID | 107133067 |
| Molecular Formula | C10H16F3NO2S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | ethyl 2-(thiolan-3-yl)-2-(2,2,2-trifluoroethylamino)acetate |
| SMILES | CCOC(=O)C(NCC(F)(F)F)C1CCSC1 |
| InChI | InChI=1S/C10H16F3NO2S/c1-2-16-9(15)8(7-3-4-17-5-7)14-6-10(11,12)13/h7-8,14H,2-6H2,1H3 |
| InChIKey | TXQJXVUQWMPXSH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |