C22H28O7 — CID 10716198
[(3bS,5R,5aR,6R,7R,9aR,9bR)-5,7-dihydroxy-3b,9b-dimethyl-4-oxospiro[7,8,9,9a,10,11-hexahydro-5H-naphtho[1,2-g][1]benzofuran-6,2'-oxirane]-5a-yl]methyl acetate (PubChem CID 10716198) has the molecular formula C22H28O7 and a molecular weight of 404.46 g/mol. Its IUPAC name is [(3bS,5R,5aR,6R,7R,9aR,9bR)-5,7-dihydroxy-3b,9b-dimethyl-4-oxospiro[7,8,9,9a,10,11-hexahydro-5H-naphtho[1,2-g][1]benzofuran-6,2'-oxirane]-5a-yl]methyl acetate.
| Compound Name | [(3bS,5R,5aR,6R,7R,9aR,9bR)-5,7-dihydroxy-3b,9b-dimethyl-4-oxospiro[7,8,9,9a,10,11-hexahydro-5H-naphtho[1,2-g][1]benzofuran-6,2'-oxirane]-5a-yl]methyl acetate |
|---|---|
| PubChem CID | 10716198 |
| Molecular Formula | C22H28O7 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | [(3bS,5R,5aR,6R,7R,9aR,9bR)-5,7-dihydroxy-3b,9b-dimethyl-4-oxospiro[7,8,9,9a,10,11-hexahydro-5H-naphtho[1,2-g][1]benzofuran-6,2'-oxirane]-5a-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]12[C@@H](O)C(=O)[C@]3(C)c4occc4CC[C@]3(C)[C@H]1CC[C@@H](O)[C@]21CO1 |
| InChI | InChI=1S/C22H28O7/c1-12(23)28-10-21-14(4-5-15(24)22(21)11-29-22)19(2)8-6-13-7-9-27-18(13)20(19,3)16(25)17(21)26/h7,9,14-15,17,24,26H,4-6,8,10-11H2,1-3H3/t14-,15-,17+,19-,20-,21+,22-/m1/s1 |
| InChIKey | MGXGMPDTXPLOBK-KKWIGBANSA-N |
| XLogP | 1.52 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|