C9H21N5 — CID 107164251
1-amino-2-[(1,4-dimethylpiperidin-4-yl)methyl]guanidine (PubChem CID 107164251) has the molecular formula C9H21N5 and a molecular weight of 199.30 g/mol. Its IUPAC name is 1-amino-2-[(1,4-dimethylpiperidin-4-yl)methyl]guanidine.
| Compound Name | 1-amino-2-[(1,4-dimethylpiperidin-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 107164251 |
| Molecular Formula | C9H21N5 |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.18 |
| IUPAC Name | 1-amino-2-[(1,4-dimethylpiperidin-4-yl)methyl]guanidine |
| SMILES | CN1CCC(C)(C/N=C(\N)NN)CC1 |
| InChI | InChI=1S/C9H21N5/c1-9(7-12-8(10)13-11)3-5-14(2)6-4-9/h3-7,11H2,1-2H3,(H3,10,12,13) |
| InChIKey | MYLUUVGEPQUCBB-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|