C20H33NO8 — CID 10716750
[(1R)-2-(diethylamino)-2-oxo-1-[(1R,2S,6R,7R,9R)-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-7-yl]ethyl] acetate (PubChem CID 10716750) has the molecular formula C20H33NO8 and a molecular weight of 415.48 g/mol. Its IUPAC name is [(1R)-2-(diethylamino)-2-oxo-1-[(1R,2S,6R,7R,9R)-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-7-yl]ethyl] acetate.
| Compound Name | [(1R)-2-(diethylamino)-2-oxo-1-[(1R,2S,6R,7R,9R)-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-7-yl]ethyl] acetate |
|---|---|
| PubChem CID | 10716750 |
| Molecular Formula | C20H33NO8 |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | [(1R)-2-(diethylamino)-2-oxo-1-[(1R,2S,6R,7R,9R)-4,4,12,12-tetramethyl-3,5,8,11,13-pentaoxatricyclo[7.4.0.02,6]tridecan-7-yl]ethyl] acetate |
| SMILES | CCN(CC)C(=O)[C@H](OC(C)=O)[C@@H]1O[C@@H]2COC(C)(C)O[C@H]2[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C20H33NO8/c1-8-21(9-2)18(23)17(25-11(3)22)14-16-15(28-20(6,7)29-16)13-12(26-14)10-24-19(4,5)27-13/h12-17H,8-10H2,1-7H3/t12-,13-,14-,15+,16-,17-/m1/s1 |
| InChIKey | YYSVIMQLRAIMQZ-NWHWRWDZSA-N |
| XLogP | 1.23 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |