C21H33NO10 — CID 10504132
[(4R,5R)-4-[(1S,2R)-1,2-diacetyloxy-2-[(2R,3S)-3-(diethylcarbamoyl)oxiran-2-yl]ethyl]-2,2-dimethyl-1,3-dioxan-5-yl] acetate (PubChem CID 10504132) has the molecular formula C21H33NO10 and a molecular weight of 459.49 g/mol. Its IUPAC name is [(4R,5R)-4-[(1S,2R)-1,2-diacetyloxy-2-[(2R,3S)-3-(diethylcarbamoyl)oxiran-2-yl]ethyl]-2,2-dimethyl-1,3-dioxan-5-yl] acetate.
| Compound Name | [(4R,5R)-4-[(1S,2R)-1,2-diacetyloxy-2-[(2R,3S)-3-(diethylcarbamoyl)oxiran-2-yl]ethyl]-2,2-dimethyl-1,3-dioxan-5-yl] acetate |
|---|---|
| PubChem CID | 10504132 |
| Molecular Formula | C21H33NO10 |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | [(4R,5R)-4-[(1S,2R)-1,2-diacetyloxy-2-[(2R,3S)-3-(diethylcarbamoyl)oxiran-2-yl]ethyl]-2,2-dimethyl-1,3-dioxan-5-yl] acetate |
| SMILES | CCN(CC)C(=O)[C@H]1O[C@@H]1[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)(C)OC[C@H]1OC(C)=O |
| InChI | InChI=1S/C21H33NO10/c1-8-22(9-2)20(26)19-18(31-19)17(30-13(5)25)16(29-12(4)24)15-14(28-11(3)23)10-27-21(6,7)32-15/h14-19H,8-10H2,1-7H3/t14-,15-,16+,17+,18-,19+/m1/s1 |
| InChIKey | AIRHBBUODSZCSU-NYLIBXOJSA-N |
| XLogP | 0.57 |
| TPSA | 130.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|