C20H20ClF3O4 — CID 10716835
[(2S,3S)-3-chloro-1,4-bis(phenylmethoxy)butan-2-yl] 2,2,2-trifluoroacetate (PubChem CID 10716835) has the molecular formula C20H20ClF3O4 and a molecular weight of 416.82 g/mol. Its IUPAC name is [(2S,3S)-3-chloro-1,4-bis(phenylmethoxy)butan-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(2S,3S)-3-chloro-1,4-bis(phenylmethoxy)butan-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 10716835 |
| Molecular Formula | C20H20ClF3O4 |
| Molecular Weight | 416.82 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | [(2S,3S)-3-chloro-1,4-bis(phenylmethoxy)butan-2-yl] 2,2,2-trifluoroacetate |
| SMILES | O=C(O[C@@H](COCc1ccccc1)[C@@H](Cl)COCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C20H20ClF3O4/c21-17(13-26-11-15-7-3-1-4-8-15)18(28-19(25)20(22,23)24)14-27-12-16-9-5-2-6-10-16/h1-10,17-18H,11-14H2/t17-,18-/m0/s1 |
| InChIKey | HDCRZUDAHLGTSJ-ROUUACIJSA-N |
| XLogP | 4.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.82 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|