C29H44O3 — CID 10717960
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R,4E)-2-(4-methoxyphenyl)-5,9-dimethyldeca-4,8-dienoate (PubChem CID 10717960) has the molecular formula C29H44O3 and a molecular weight of 440.67 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R,4E)-2-(4-methoxyphenyl)-5,9-dimethyldeca-4,8-dienoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R,4E)-2-(4-methoxyphenyl)-5,9-dimethyldeca-4,8-dienoate |
|---|---|
| PubChem CID | 10717960 |
| Molecular Formula | C29H44O3 |
| Molecular Weight | 440.67 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R,4E)-2-(4-methoxyphenyl)-5,9-dimethyldeca-4,8-dienoate |
| SMILES | COc1ccc([C@@H](C/C=C(\C)CCC=C(C)C)C(=O)O[C@@H]2C[C@H](C)CC[C@H]2C(C)C)cc1 |
| InChI | InChI=1S/C29H44O3/c1-20(2)9-8-10-22(5)11-18-27(24-13-15-25(31-7)16-14-24)29(30)32-28-19-23(6)12-17-26(28)21(3)4/h9,11,13-16,21,23,26-28H,8,10,12,17-19H2,1-7H3/b22-11+/t23-,26+,27-,28-/m1/s1 |
| InChIKey | XTIFDCUOUMIIBO-HLVMLQSISA-N |
| XLogP | 7.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.67 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|