C13H14ClN3O4 — CID 107196169
methyl 5-amino-3-chloro-2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]benzoate (PubChem CID 107196169) has the molecular formula C13H14ClN3O4 and a molecular weight of 311.73 g/mol. Its IUPAC name is methyl 5-amino-3-chloro-2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]benzoate.
| Compound Name | methyl 5-amino-3-chloro-2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]benzoate |
|---|---|
| PubChem CID | 107196169 |
| Molecular Formula | C13H14ClN3O4 |
| Molecular Weight | 311.73 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | methyl 5-amino-3-chloro-2-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]benzoate |
| SMILES | COC(=O)c1cc(N)cc(Cl)c1NC1CC(=O)N(C)C1=O |
| InChI | InChI=1S/C13H14ClN3O4/c1-17-10(18)5-9(12(17)19)16-11-7(13(20)21-2)3-6(15)4-8(11)14/h3-4,9,16H,5,15H2,1-2H3 |
| InChIKey | GDSRALJPMCQPNQ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.73 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|