C15H20ClN3O2 — CID 107193254
methyl 5-amino-2-(1-azabicyclo[2.2.2]octan-3-ylamino)-3-chlorobenzoate (PubChem CID 107193254) has the molecular formula C15H20ClN3O2 and a molecular weight of 309.80 g/mol. Its IUPAC name is methyl 5-amino-2-(1-azabicyclo[2.2.2]octan-3-ylamino)-3-chlorobenzoate.
| Compound Name | methyl 5-amino-2-(1-azabicyclo[2.2.2]octan-3-ylamino)-3-chlorobenzoate |
|---|---|
| PubChem CID | 107193254 |
| Molecular Formula | C15H20ClN3O2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | methyl 5-amino-2-(1-azabicyclo[2.2.2]octan-3-ylamino)-3-chlorobenzoate |
| SMILES | COC(=O)c1cc(N)cc(Cl)c1NC1CN2CCC1CC2 |
| InChI | InChI=1S/C15H20ClN3O2/c1-21-15(20)11-6-10(17)7-12(16)14(11)18-13-8-19-4-2-9(13)3-5-19/h6-7,9,13,18H,2-5,8,17H2,1H3 |
| InChIKey | DAZOUZKNOWGESC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|