C15H21ClN2O2 — CID 107196244
methyl 5-amino-3-chloro-2-[(2,2,3,3-tetramethylcyclopropyl)amino]benzoate (PubChem CID 107196244) has the molecular formula C15H21ClN2O2 and a molecular weight of 296.80 g/mol. Its IUPAC name is methyl 5-amino-3-chloro-2-[(2,2,3,3-tetramethylcyclopropyl)amino]benzoate.
| Compound Name | methyl 5-amino-3-chloro-2-[(2,2,3,3-tetramethylcyclopropyl)amino]benzoate |
|---|---|
| PubChem CID | 107196244 |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | methyl 5-amino-3-chloro-2-[(2,2,3,3-tetramethylcyclopropyl)amino]benzoate |
| SMILES | COC(=O)c1cc(N)cc(Cl)c1NC1C(C)(C)C1(C)C |
| InChI | InChI=1S/C15H21ClN2O2/c1-14(2)13(15(14,3)4)18-11-9(12(19)20-5)6-8(17)7-10(11)16/h6-7,13,18H,17H2,1-5H3 |
| InChIKey | BGSIWVZACQVIQG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|