C16H23ClN2O2 — CID 107196102
methyl 5-amino-3-chloro-2-[(3-ethyl-2-methylcyclopentyl)amino]benzoate (PubChem CID 107196102) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.83 g/mol. Its IUPAC name is methyl 5-amino-3-chloro-2-[(3-ethyl-2-methylcyclopentyl)amino]benzoate.
| Compound Name | methyl 5-amino-3-chloro-2-[(3-ethyl-2-methylcyclopentyl)amino]benzoate |
|---|---|
| PubChem CID | 107196102 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | methyl 5-amino-3-chloro-2-[(3-ethyl-2-methylcyclopentyl)amino]benzoate |
| SMILES | CCC1CCC(Nc2c(Cl)cc(N)cc2C(=O)OC)C1C |
| InChI | InChI=1S/C16H23ClN2O2/c1-4-10-5-6-14(9(10)2)19-15-12(16(20)21-3)7-11(18)8-13(15)17/h7-10,14,19H,4-6,18H2,1-3H3 |
| InChIKey | UXDQCELGVODCJE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|