C23H19ClN4O3S3 — CID 10720992
1-[4-[2-[(4-chlorophenyl)sulfonylamino]phenyl]-1,3-thiazol-2-yl]-3-(4-methoxyphenyl)thiourea (PubChem CID 10720992) has the molecular formula C23H19ClN4O3S3 and a molecular weight of 531.08 g/mol. Its IUPAC name is 1-[4-[2-[(4-chlorophenyl)sulfonylamino]phenyl]-1,3-thiazol-2-yl]-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[4-[2-[(4-chlorophenyl)sulfonylamino]phenyl]-1,3-thiazol-2-yl]-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 10720992 |
| Molecular Formula | C23H19ClN4O3S3 |
| Molecular Weight | 531.08 g/mol |
| Exact Mass | 530.03 |
| IUPAC Name | 1-[4-[2-[(4-chlorophenyl)sulfonylamino]phenyl]-1,3-thiazol-2-yl]-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)Nc2nc(-c3ccccc3NS(=O)(=O)c3ccc(Cl)cc3)cs2)cc1 |
| InChI | InChI=1S/C23H19ClN4O3S3/c1-31-17-10-8-16(9-11-17)25-22(32)27-23-26-21(14-33-23)19-4-2-3-5-20(19)28-34(29,30)18-12-6-15(24)7-13-18/h2-14,28H,1H3,(H2,25,26,27,32) |
| InChIKey | ZNICVKQEWWUKJG-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.08 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|