C24H21ClN4O2S3 — CID 10816023
1-[4-[2-[(4-chlorophenyl)sulfonylamino]phenyl]-1,3-thiazol-2-yl]-3-(3,4-dimethylphenyl)thiourea (PubChem CID 10816023) has the molecular formula C24H21ClN4O2S3 and a molecular weight of 529.11 g/mol. Its IUPAC name is 1-[4-[2-[(4-chlorophenyl)sulfonylamino]phenyl]-1,3-thiazol-2-yl]-3-(3,4-dimethylphenyl)thiourea.
| Compound Name | 1-[4-[2-[(4-chlorophenyl)sulfonylamino]phenyl]-1,3-thiazol-2-yl]-3-(3,4-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 10816023 |
| Molecular Formula | C24H21ClN4O2S3 |
| Molecular Weight | 529.11 g/mol |
| Exact Mass | 528.05 |
| IUPAC Name | 1-[4-[2-[(4-chlorophenyl)sulfonylamino]phenyl]-1,3-thiazol-2-yl]-3-(3,4-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2nc(-c3ccccc3NS(=O)(=O)c3ccc(Cl)cc3)cs2)cc1C |
| InChI | InChI=1S/C24H21ClN4O2S3/c1-15-7-10-18(13-16(15)2)26-23(32)28-24-27-22(14-33-24)20-5-3-4-6-21(20)29-34(30,31)19-11-8-17(25)9-12-19/h3-14,29H,1-2H3,(H2,26,27,28,32) |
| InChIKey | QXRFANLWHRJVFX-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.11 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|