C11H15ClN2O4S — CID 107213252
(3S,4R)-1-(5-amino-4-chloro-2-methylphenyl)sulfonylpyrrolidine-3,4-diol (PubChem CID 107213252) has the molecular formula C11H15ClN2O4S and a molecular weight of 306.77 g/mol. Its IUPAC name is (3S,4R)-1-(5-amino-4-chloro-2-methylphenyl)sulfonylpyrrolidine-3,4-diol.
| Compound Name | (3S,4R)-1-(5-amino-4-chloro-2-methylphenyl)sulfonylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 107213252 |
| Molecular Formula | C11H15ClN2O4S |
| Molecular Weight | 306.77 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | (3S,4R)-1-(5-amino-4-chloro-2-methylphenyl)sulfonylpyrrolidine-3,4-diol |
| SMILES | Cc1cc(Cl)c(N)cc1S(=O)(=O)N1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C11H15ClN2O4S/c1-6-2-7(12)8(13)3-11(6)19(17,18)14-4-9(15)10(16)5-14/h2-3,9-10,15-16H,4-5,13H2,1H3/t9-,10+ |
| InChIKey | GTIDBVHGBPTWAY-AOOOYVTPSA-N |
| XLogP | -0.04 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.77 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|