C12H20N2O2 — CID 107221925
2-(azetidin-3-ylidene)-N-[(1R,2R)-2-hydroxycyclohexyl]propanamide (PubChem CID 107221925) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-(azetidin-3-ylidene)-N-[(1R,2R)-2-hydroxycyclohexyl]propanamide.
| Compound Name | 2-(azetidin-3-ylidene)-N-[(1R,2R)-2-hydroxycyclohexyl]propanamide |
|---|---|
| PubChem CID | 107221925 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 2-(azetidin-3-ylidene)-N-[(1R,2R)-2-hydroxycyclohexyl]propanamide |
| SMILES | CC(C(=O)N[C@@H]1CCCC[C@H]1O)=C1CNC1 |
| InChI | InChI=1S/C12H20N2O2/c1-8(9-6-13-7-9)12(16)14-10-4-2-3-5-11(10)15/h10-11,13,15H,2-7H2,1H3,(H,14,16)/t10-,11-/m1/s1 |
| InChIKey | ZPMBGHDGJOVNFM-GHMZBOCLSA-N |
| XLogP | 0.33 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|