C16H21FN4O2 — CID 107240522
tert-butyl N-[2-fluoro-5-[1-(1H-pyrazol-5-yl)ethylamino]phenyl]carbamate (PubChem CID 107240522) has the molecular formula C16H21FN4O2 and a molecular weight of 320.37 g/mol. Its IUPAC name is tert-butyl N-[2-fluoro-5-[1-(1H-pyrazol-5-yl)ethylamino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-fluoro-5-[1-(1H-pyrazol-5-yl)ethylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 107240522 |
| Molecular Formula | C16H21FN4O2 |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | tert-butyl N-[2-fluoro-5-[1-(1H-pyrazol-5-yl)ethylamino]phenyl]carbamate |
| SMILES | CC(Nc1ccc(F)c(NC(=O)OC(C)(C)C)c1)c1ccn[nH]1 |
| InChI | InChI=1S/C16H21FN4O2/c1-10(13-7-8-18-21-13)19-11-5-6-12(17)14(9-11)20-15(22)23-16(2,3)4/h5-10,19H,1-4H3,(H,18,21)(H,20,22) |
| InChIKey | LXZRHNKTJGVNKJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |