C6H8N2O — CID 10725341
1-methyl-2,4-diazabicyclo[3.2.0]hept-6-en-3-one (PubChem CID 10725341) has the molecular formula C6H8N2O and a molecular weight of 124.14 g/mol. Its IUPAC name is 1-methyl-2,4-diazabicyclo[3.2.0]hept-6-en-3-one.
| Compound Name | 1-methyl-2,4-diazabicyclo[3.2.0]hept-6-en-3-one |
|---|---|
| PubChem CID | 10725341 |
| Molecular Formula | C6H8N2O |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.06 |
| IUPAC Name | 1-methyl-2,4-diazabicyclo[3.2.0]hept-6-en-3-one |
| SMILES | CC12C=CC1NC(=O)N2 |
| InChI | InChI=1S/C6H8N2O/c1-6-3-2-4(6)7-5(9)8-6/h2-4H,1H3,(H2,7,8,9) |
| InChIKey | OFUSJDMYHUVGMQ-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|