About 2-bromo-4-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]benzonitrile
2-bromo-4-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]benzonitrile (PubChem CID 107276454) has the molecular formula C13H6BrClN4S
and a molecular weight of 365.64 g/mol. Its IUPAC name is 2-bromo-4-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]benzonitrile.
Molecular Properties
| Compound Name | 2-bromo-4-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]benzonitrile |
| PubChem CID | 107276454 |
| Molecular Formula | C13H6BrClN4S |
| Molecular Weight | 365.64 g/mol |
| Exact Mass | 363.92 |
| IUPAC Name | 2-bromo-4-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2c(Cl)ccc3nsnc23)cc1Br |
| InChI | InChI=1S/C13H6BrClN4S/c14-9-5-8(2-1-7(9)6-16)17-12-10(15)3-4-11-13(12)19-20-18-11/h1-5,17H |
| InChIKey | XHRWTPKMTGIULZ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.64 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-bromo-4-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]benzonitrile?
The IUPAC name of 2-bromo-4-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]benzonitrile (CID 107276454) is 2-bromo-4-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]benzonitrile.
What is the SMILES notation for 2-bromo-4-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]benzonitrile?
The canonical SMILES for 2-bromo-4-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]benzonitrile is N#Cc1ccc(Nc2c(Cl)ccc3nsnc23)cc1Br.
What is the InChIKey of 2-bromo-4-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]benzonitrile?
The InChIKey is XHRWTPKMTGIULZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6BrClN4S/c14-9-5-8(2-1-7(9)6-16)17-12-10(15)3-4-11-13(12)19-20-18-11/h1-5,17H.
What are the key properties of 2-bromo-4-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]benzonitrile?
2-bromo-4-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]benzonitrile has a molecular weight of 365.64 g/mol, XLogP of 4.72, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]benzonitrile is sourced from PubChem (CID 107276454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).