C15H19ClN4 — CID 107316196
(R)-(2-chlorophenyl)-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)methanamine (PubChem CID 107316196) has the molecular formula C15H19ClN4 and a molecular weight of 290.80 g/mol. Its IUPAC name is (R)-(2-chlorophenyl)-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)methanamine.
| Compound Name | (R)-(2-chlorophenyl)-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)methanamine |
|---|---|
| PubChem CID | 107316196 |
| Molecular Formula | C15H19ClN4 |
| Molecular Weight | 290.80 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | (R)-(2-chlorophenyl)-(5-cyclohexyl-1H-1,2,4-triazol-3-yl)methanamine |
| SMILES | N[C@@H](c1n[nH]c(C2CCCCC2)n1)c1ccccc1Cl |
| InChI | InChI=1S/C15H19ClN4/c16-12-9-5-4-8-11(12)13(17)15-18-14(19-20-15)10-6-2-1-3-7-10/h4-5,8-10,13H,1-3,6-7,17H2,(H,18,19,20)/t13-/m1/s1 |
| InChIKey | MGVBGCZDFUONHA-CYBMUJFWSA-N |
| XLogP | 3.55 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.80 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |