C17H9N3O2 — CID 10732016
3-pyridin-2-ylbenzo[g]quinoxaline-5,10-dione (PubChem CID 10732016) has the molecular formula C17H9N3O2 and a molecular weight of 287.28 g/mol. Its IUPAC name is 3-pyridin-2-ylbenzo[g]quinoxaline-5,10-dione.
| Compound Name | 3-pyridin-2-ylbenzo[g]quinoxaline-5,10-dione |
|---|---|
| PubChem CID | 10732016 |
| Molecular Formula | C17H9N3O2 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 3-pyridin-2-ylbenzo[g]quinoxaline-5,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2nc(-c3ccccn3)cnc21 |
| InChI | InChI=1S/C17H9N3O2/c21-16-10-5-1-2-6-11(10)17(22)15-14(16)19-9-13(20-15)12-7-3-4-8-18-12/h1-9H |
| InChIKey | ZOGMJEQGMURZJX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 72.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|