C11H9BrF3N3O2 — CID 107336169
2-[3-bromo-4-(trifluoromethoxy)anilino]-N-(cyanomethyl)acetamide (PubChem CID 107336169) has the molecular formula C11H9BrF3N3O2 and a molecular weight of 352.11 g/mol. Its IUPAC name is 2-[3-bromo-4-(trifluoromethoxy)anilino]-N-(cyanomethyl)acetamide.
| Compound Name | 2-[3-bromo-4-(trifluoromethoxy)anilino]-N-(cyanomethyl)acetamide |
|---|---|
| PubChem CID | 107336169 |
| Molecular Formula | C11H9BrF3N3O2 |
| Molecular Weight | 352.11 g/mol |
| Exact Mass | 350.98 |
| IUPAC Name | 2-[3-bromo-4-(trifluoromethoxy)anilino]-N-(cyanomethyl)acetamide |
| SMILES | N#CCNC(=O)CNc1ccc(OC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C11H9BrF3N3O2/c12-8-5-7(18-6-10(19)17-4-3-16)1-2-9(8)20-11(13,14)15/h1-2,5,18H,4,6H2,(H,17,19) |
| InChIKey | XUTCUPUVZWWVBL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.11 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|