About 6-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pyridin-3-amine
6-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pyridin-3-amine (PubChem CID 107339976) has the molecular formula C16H19N3
and a molecular weight of 253.35 g/mol. Its IUPAC name is 6-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pyridin-3-amine.
Molecular Properties
| Compound Name | 6-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pyridin-3-amine |
| PubChem CID | 107339976 |
| Molecular Formula | C16H19N3 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 6-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pyridin-3-amine |
| SMILES | Nc1ccc(CCN2CCc3ccccc3C2)nc1 |
| InChI | InChI=1S/C16H19N3/c17-15-5-6-16(18-11-15)8-10-19-9-7-13-3-1-2-4-14(13)12-19/h1-6,11H,7-10,12,17H2 |
| InChIKey | SWGVSAXRNYMLST-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pyridin-3-amine?
The IUPAC name of 6-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pyridin-3-amine (CID 107339976) is 6-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pyridin-3-amine.
What is the SMILES notation for 6-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pyridin-3-amine?
The canonical SMILES for 6-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pyridin-3-amine is Nc1ccc(CCN2CCc3ccccc3C2)nc1.
What is the InChIKey of 6-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pyridin-3-amine?
The InChIKey is SWGVSAXRNYMLST-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3/c17-15-5-6-16(18-11-15)8-10-19-9-7-13-3-1-2-4-14(13)12-19/h1-6,11H,7-10,12,17H2.
What are the key properties of 6-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pyridin-3-amine?
6-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pyridin-3-amine has a molecular weight of 253.35 g/mol, XLogP of 2.26, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(3,4-dihydro-1H-isoquinolin-2-yl)ethyl]pyridin-3-amine is sourced from PubChem (CID 107339976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).