About 2,2-dibromo-1,1-dimethoxyhexan-3-one
2,2-dibromo-1,1-dimethoxyhexan-3-one (PubChem CID 10734293) has the molecular formula C8H14Br2O3
and a molecular weight of 318.01 g/mol. Its IUPAC name is 2,2-dibromo-1,1-dimethoxyhexan-3-one.
Molecular Properties
| Compound Name | 2,2-dibromo-1,1-dimethoxyhexan-3-one |
| PubChem CID | 10734293 |
| Molecular Formula | C8H14Br2O3 |
| Molecular Weight | 318.01 g/mol |
| Exact Mass | 315.93 |
| IUPAC Name | 2,2-dibromo-1,1-dimethoxyhexan-3-one |
| SMILES | CCCC(=O)C(Br)(Br)C(OC)OC |
| InChI | InChI=1S/C8H14Br2O3/c1-4-5-6(11)8(9,10)7(12-2)13-3/h7H,4-5H2,1-3H3 |
| InChIKey | RMOQESWWSIEZND-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.01 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dibromo-1,1-dimethoxyhexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dibromo-1,1-dimethoxyhexan-3-one?
The IUPAC name of 2,2-dibromo-1,1-dimethoxyhexan-3-one (CID 10734293) is 2,2-dibromo-1,1-dimethoxyhexan-3-one.
What is the SMILES notation for 2,2-dibromo-1,1-dimethoxyhexan-3-one?
The canonical SMILES for 2,2-dibromo-1,1-dimethoxyhexan-3-one is CCCC(=O)C(Br)(Br)C(OC)OC.
What is the InChIKey of 2,2-dibromo-1,1-dimethoxyhexan-3-one?
The InChIKey is RMOQESWWSIEZND-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14Br2O3/c1-4-5-6(11)8(9,10)7(12-2)13-3/h7H,4-5H2,1-3H3.
What are the key properties of 2,2-dibromo-1,1-dimethoxyhexan-3-one?
2,2-dibromo-1,1-dimethoxyhexan-3-one has a molecular weight of 318.01 g/mol, XLogP of 2.46, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dibromo-1,1-dimethoxyhexan-3-one is sourced from PubChem (CID 10734293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).