C24H32N4 — CID 10738319
5-(2,6-dibutylphenyl)-2-(2-phenylpropan-2-yl)tetrazole (PubChem CID 10738319) has the molecular formula C24H32N4 and a molecular weight of 376.55 g/mol. Its IUPAC name is 5-(2,6-dibutylphenyl)-2-(2-phenylpropan-2-yl)tetrazole.
| Compound Name | 5-(2,6-dibutylphenyl)-2-(2-phenylpropan-2-yl)tetrazole |
|---|---|
| PubChem CID | 10738319 |
| Molecular Formula | C24H32N4 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | 5-(2,6-dibutylphenyl)-2-(2-phenylpropan-2-yl)tetrazole |
| SMILES | CCCCc1cccc(CCCC)c1-c1nnn(C(C)(C)c2ccccc2)n1 |
| InChI | InChI=1S/C24H32N4/c1-5-7-13-19-15-12-16-20(14-8-6-2)22(19)23-25-27-28(26-23)24(3,4)21-17-10-9-11-18-21/h9-12,15-18H,5-8,13-14H2,1-4H3 |
| InChIKey | CFMIFXDBZNXPTO-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |