C19H27NO8 — CID 10739569
[(2S)-2-[(2R,3R,4S,5R)-5-hydroxy-3,4-bis(methoxymethyl)oxolan-2-yl]butyl] 4-nitrobenzoate (PubChem CID 10739569) has the molecular formula C19H27NO8 and a molecular weight of 397.42 g/mol. Its IUPAC name is [(2S)-2-[(2R,3R,4S,5R)-5-hydroxy-3,4-bis(methoxymethyl)oxolan-2-yl]butyl] 4-nitrobenzoate.
| Compound Name | [(2S)-2-[(2R,3R,4S,5R)-5-hydroxy-3,4-bis(methoxymethyl)oxolan-2-yl]butyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 10739569 |
| Molecular Formula | C19H27NO8 |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | [(2S)-2-[(2R,3R,4S,5R)-5-hydroxy-3,4-bis(methoxymethyl)oxolan-2-yl]butyl] 4-nitrobenzoate |
| SMILES | CC[C@@H](COC(=O)c1ccc([N+](=O)[O-])cc1)[C@H]1O[C@@H](O)[C@H](COC)[C@@H]1COC |
| InChI | InChI=1S/C19H27NO8/c1-4-12(17-15(10-25-2)16(11-26-3)19(22)28-17)9-27-18(21)13-5-7-14(8-6-13)20(23)24/h5-8,12,15-17,19,22H,4,9-11H2,1-3H3/t12-,15-,16+,17+,19+/m0/s1 |
| InChIKey | ITAFMQGVZOZPBR-LUDPGVCASA-N |
| XLogP | 2.02 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|