C10H10N4O3S — CID 107409650
2-[2-(3,5-dioxo-1,2,4-triazolidin-4-yl)phenoxy]ethanethioamide (PubChem CID 107409650) has the molecular formula C10H10N4O3S and a molecular weight of 266.28 g/mol. Its IUPAC name is 2-[2-(3,5-dioxo-1,2,4-triazolidin-4-yl)phenoxy]ethanethioamide.
| Compound Name | 2-[2-(3,5-dioxo-1,2,4-triazolidin-4-yl)phenoxy]ethanethioamide |
|---|---|
| PubChem CID | 107409650 |
| Molecular Formula | C10H10N4O3S |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 2-[2-(3,5-dioxo-1,2,4-triazolidin-4-yl)phenoxy]ethanethioamide |
| SMILES | NC(=S)COc1ccccc1-n1c(=O)[nH][nH]c1=O |
| InChI | InChI=1S/C10H10N4O3S/c11-8(18)5-17-7-4-2-1-3-6(7)14-9(15)12-13-10(14)16/h1-4H,5H2,(H2,11,18)(H,12,15)(H,13,16) |
| InChIKey | WLDMCYIDUPIETC-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|